For research use only. Not for therapeutic Use.
Chaulmoogric acid is a fatty acid extracted from the seeds of the chaulmoogra tree. Historically significant in the treatment of leprosy, it possesses antimicrobial and anti-inflammatory properties. Its unique structure allows for the disruption of bacterial cell walls, making it effective against Mycobacterium leprae. Modern research explores its potential in treating other skin conditions and infections.
CAS Number | 29106-32-9 |
Synonyms | (S)-2-Cyclopentene-1-tridecanoic Acid; (1S)-2-Cyclopentene-1-tridecanoic Acid; NSC 14979; NSC 26989; NSC 52425 |
Molecular Formula | C18H32O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 13-[(1S)-cyclopent-2-en-1-yl]tridecanoic acid |
InChI | InChI=1S/C18H32O2/c19-18(20)16-10-8-6-4-2-1-3-5-7-9-13-17-14-11-12-15-17/h11,14,17H,1-10,12-13,15-16H2,(H,19,20)/t17-/m1/s1 |
InChIKey | XMVQWNRDPAAMJB-QGZVFWFLSA-N |
SMILES | C1CC(C=C1)CCCCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |