For research use only. Not for therapeutic Use.
α-CHCA(Cat No.:I011080) is a well-known inhibitor of monocarboxylate transporters (MCTs). Among the MCT inhibitors, α-cyano-4-hydroxycinnamate (CHC) exhibits a higher selectivity for MCT1 compared to other MCTs, showing approximately 10-fold selectivity. MCTs are responsible for the transport of monocarboxylates, such as lactate and pyruvate, across cell membranes. By selectively inhibiting MCT1, CHC can modulate the transport of these metabolites, potentially impacting cellular metabolism and offering therapeutic opportunities in various physiological and pathological conditions related to MCT1 dysregulation.
CAS Number | 28166-41-8 |
Synonyms | 2-Cyano-3-(4-hydroxyphenyl)-2-propenoic acid |
Molecular Formula | C10H7NO3 |
Purity | ≥95% |
Target | Monocarboxylate Transporters |
Solubility | Soluble to 100 mM in DMSO and to 50 mM in ethanol |
Storage | 2-8°C |
IUPAC Name | (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid |
InChI | InChI=1S/C10H7NO3/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h1-5,12H,(H,13,14)/b8-5+ |
InChIKey | AFVLVVWMAFSXCK-VMPITWQZSA-N |
SMILES | C1=CC(=CC=C1C=C(C#N)C(=O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |