For research use only. Not for therapeutic Use.
Chelerythrine chloride（Cat No.:I003429）is a selective inhibitor of protein kinase C (PKC), a family of serine/threonine kinases involved in various cellular processes, including cell growth, differentiation, and apoptosis. By inhibiting PKC, chelerythrine chloride disrupts downstream signaling pathways, making it a valuable tool in cancer research and studies on inflammation. This compound has demonstrated potential effects in modulating cellular responses to stimuli, and it has been used in various experimental models to investigate the role of PKC in disease processes. Chelerythrine chloride’s unique mechanism offers insights into therapeutic strategies targeting PKC-related pathways.
| Catalog Number | I003429 |
| CAS Number | 3895-92-9 |
| Synonyms | Broussonpapyrine chloride;NSC 646662 |
| Molecular Formula | C₂₁H₁₈NO₄Cl |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| Solubility | DMSO: ＞ 3.9 mg/mL |
| Storage | Store at -20°C |
| IC50 | 600 nM |
| IUPAC Name | 1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium;chloride |
| InChI | InChI=1S/C21H18NO4.ClH/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22;/h4-10H,11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WEEFNMFMNMASJY-UHFFFAOYSA-M |
| SMILES | C[N+]1=C2C(=C3C=CC(=C(C3=C1)OC)OC)C=CC4=CC5=C(C=C42)OCO5.[Cl-] |
| Reference | <p style=/line-height:25px/> |
