For research use only, not for therapeutic use.
Chelerythrine（Cat No.:R036019）is a natural alkaloid derived from the plant Zanthoxylum, known for its potent inhibitory effects on protein kinase C (PKC). By inhibiting PKC, chelerythrine modulates various signaling pathways involved in cell growth, differentiation, and apoptosis. This compound has demonstrated anti-inflammatory, anti-cancer, and neuroprotective properties in preclinical studies, making it of interest in cancer research and treatment. Chelerythrine’s ability to influence cellular processes underscores its potential as a therapeutic agent, as well as a valuable tool for investigating PKC-related pathways in various disease models.
| Catalog Number | R036019 |
| CAS Number | 34316-15-9 |
| Synonyms | 1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
| Molecular Formula | C21H18NO4+ |
| Purity | ≥95% |
| Target | PKC |
| Solubility | >19.2mg/mL in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium |
| InChI | InChI=1S/C21H18NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-10H,11H2,1-3H3/q+1 |
| InChIKey | LLEJIEBFSOEYIV-UHFFFAOYSA-N |
| SMILES | C[N+]1=C2C(=C3C=CC(=C(C3=C1)OC)OC)C=CC4=CC5=C(C=C42)OCO5 |
