For research use only. Not for therapeutic Use.
Chelidonine (Cat No.: M015374) is an alkaloid compound derived from the plant Chelidonium majus (greater celandine). It has shown a range of biological activities, including anticancer, antimicrobial, and anti-inflammatory properties. Studies suggest that chelidonine may inhibit tumor cell proliferation and induce apoptosis in various cancer cell lines, making it a potential candidate for cancer therapy. Additionally, it has been explored for its analgesic and hepatoprotective effects. However, further research is needed to fully understand its pharmacological mechanisms and therapeutic potential.
| Catalog Number | M015374 |
| CAS Number | 476-32-4 |
| Synonyms | chelidoniny;helidonine;khelidonin;STYLOPHORIN;STYLOPHORINE;STYLOPHORON;CHELIDONIN;(+)-CHELIDONINE |
| Molecular Formula | C20H19NO5 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | (1S,12S,13R)-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaen-12-ol |
| InChI | InChI=1S/C20H19NO5/c1-21-7-13-11(2-3-15-20(13)26-9-23-15)18-14(22)4-10-5-16-17(25-8-24-16)6-12(10)19(18)21/h2-3,5-6,14,18-19,22H,4,7-9H2,1H3/t14-,18-,19+/m0/s1 |
| InChIKey | GHKISGDRQRSCII-ZOCIIQOWSA-N |
| SMILES | CN1CC2=C(C=CC3=C2OCO3)C4C1C5=CC6=C(C=C5CC4O)OCO6 |
