For research use only. Not for therapeutic Use.
Chelidonine (Cat No.: M015374) is an alkaloid compound derived from the plant Chelidonium majus (greater celandine). It has shown a range of biological activities, including anticancer, antimicrobial, and anti-inflammatory properties. Studies suggest that chelidonine may inhibit tumor cell proliferation and induce apoptosis in various cancer cell lines, making it a potential candidate for cancer therapy. Additionally, it has been explored for its analgesic and hepatoprotective effects. However, further research is needed to fully understand its pharmacological mechanisms and therapeutic potential.
CAS Number | 476-32-4 |
Synonyms | chelidoniny;helidonine;khelidonin;STYLOPHORIN;STYLOPHORINE;STYLOPHORON;CHELIDONIN;(+)-CHELIDONINE |
Molecular Formula | C20H19NO5 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | (1S,12S,13R)-24-methyl-5,7,18,20-tetraoxa-24-azahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-2,4(8),9,14(22),15,17(21)-hexaen-12-ol |
InChI | InChI=1S/C20H19NO5/c1-21-7-13-11(2-3-15-20(13)26-9-23-15)18-14(22)4-10-5-16-17(25-8-24-16)6-12(10)19(18)21/h2-3,5-6,14,18-19,22H,4,7-9H2,1H3/t14-,18-,19+/m0/s1 |
InChIKey | GHKISGDRQRSCII-ZOCIIQOWSA-N |
SMILES | CN1CC2=C(C=CC3=C2OCO3)C4C1C5=CC6=C(C=C5CC4O)OCO6 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |