For research use only. Not for therapeutic Use.
Chenodeoxycholic acid-13C(Cat No.:S000797) is an isotopically labeled form of chenodeoxycholic acid (CDCA), a primary bile acid essential for cholesterol metabolism and digestion. The “13C” notation indicates that one or more carbon atoms in the chenodeoxycholic acid molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates precise tracking of CDCA metabolism and its incorporation into bile acid pathways using advanced analytical techniques like mass spectrometry. Chenodeoxycholic acid-13C serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating disorders related to bile acid metabolism.
CAS Number | 52918-92-0 |
Molecular Formula | C2313CH40O4 |
Purity | ≥95% |
Target | Autophagy |
IUPAC Name | (4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl](113C)pentanoic acid |
InChI | InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20-,22+,23+,24-/m1/s1/i21+1 |
InChIKey | RUDATBOHQWOJDD-NIOAGLPLSA-N |
SMILES | CC(CCC(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |