For research use only. Not for therapeutic Use.
Chimaphilin(CAT: R066371) is a naturally occurring naphthoquinone compound found in the leaves of certain plants, particularly in the genus Chimaphila. It is known for its distinctive yellow color and has been traditionally used in herbal medicine. Chimaphilin exhibits a range of biological activities, including antimicrobial, antifungal, and anti-inflammatory properties. Due to its potential as a therapeutic agent, it has been the subject of research in pharmacology and natural product chemistry. Studies suggest that Chimaphilin may also have antioxidant effects, contributing to its protective role against oxidative stress. Its unique chemical structure and bioactivity make Chimaphilin a valuable compound for further exploration in medicinal research.
| Catalog Number | R066371 |
| CAS Number | 482-70-2 |
| Molecular Formula | C12H10O2 |
| Purity | ≥95% |
| Target | IGF-1R |
| Storage | -20°C |
| IUPAC Name | 2,7-dimethylnaphthalene-1,4-dione |
| InChI | InChI=1S/C12H10O2/c1-7-3-4-9-10(5-7)12(14)8(2)6-11(9)13/h3-6H,1-2H3 |
| InChIKey | YZACZIYTZCJVSN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C=C(C2=O)C |
