For research use only. Not for therapeutic Use.
CHIR 99021 trihydrochloride(Cat No.:I002310)is a potent and selective inhibitor of glycogen synthase kinase-3 (GSK-3), targeting both GSK-3α and GSK-3β isoforms. By inhibiting GSK-3, CHIR 99021 enhances Wnt/β-catenin signaling, making it a valuable tool for stem cell research and regenerative medicine. It is widely used to promote self-renewal in pluripotent stem cells and to induce differentiation in specific cellular lineages. Additionally, CHIR 99021 is explored for its potential in treating neurodegenerative diseases, diabetes, and cancer, where GSK-3 plays a key regulatory role in disease progression.
CAS Number | 1782235-14-6 |
Molecular Formula | C₂₂H₁₈Cl₂N₈. 3HCl |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | DMSO: ≥ 32 mg/mL |
Storage | 3 years -20C powder |
IUPAC Name | 6-[2-[[4-(2,4-dichlorophenyl)-5-(5-methyl-1H-imidazol-2-yl)pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile;trihydrochloride |
InChI | InChI=1S/C22H18Cl2N8.3ClH/c1-13-10-29-21(31-13)17-12-30-22(32-20(17)16-4-3-15(23)8-18(16)24)27-7-6-26-19-5-2-14(9-25)11-28-19;;;/h2-5,8,10-12H,6-7H2,1H3,(H,26,28)(H,29,31)(H,27,30,32);3*1H |
InChIKey | DSFVSCNMMZRCIA-UHFFFAOYSA-N |
SMILES | CC1=CN=C(N1)C2=CN=C(N=C2C3=C(C=C(C=C3)Cl)Cl)NCCNC4=NC=C(C=C4)C#N.Cl.Cl.Cl |
Reference | <p style=/line-height:25px/> |