For research use only. Not for therapeutic Use.
Chk2 inhibitors(Cat No.:I003862)are compounds that target checkpoint kinase 2 (Chk2), a protein kinase involved in the DNA damage response and cell cycle regulation. By inhibiting Chk2, these agents disrupt the signaling pathways that promote cell cycle arrest and apoptosis in response to DNA damage. This mechanism is particularly relevant in cancer therapy, as Chk2 inhibitors can enhance the effectiveness of DNA-damaging agents and promote the survival of normal cells while selectively targeting cancer cells. Research into Chk2 inhibitors is ongoing, with the potential for their use in combination therapies to improve treatment outcomes in various malignancies.
CAS Number | 516480-79-8 |
Synonyms | 2-[4-(4-chlorophenoxy)phenyl]-3H-benzimidazole-5-carboxamide |
Molecular Formula | C₂₀H₁₄CIN₃O₂ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 55 mg/mL |
Storage | Store at -20℃ |
IC50 | 15 nM |
IUPAC Name | 2-[4-(4-chlorophenoxy)phenyl]-3H-benzimidazole-5-carboxamide |
InChI | InChI=1S/C20H14ClN3O2/c21-14-4-8-16(9-5-14)26-15-6-1-12(2-7-15)20-23-17-10-3-13(19(22)25)11-18(17)24-20/h1-11H,(H2,22,25)(H,23,24) |
InChIKey | UXGJAOIJSROTTN-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)C(=O)N)OC4=CC=C(C=C4)Cl |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |