Chk2 inhibitor（Cat No.:R066918）is a class of compounds designed to selectively inhibit checkpoint kinase 2 (Chk2), an enzyme involved in DNA damage response and cell cycle regulation. By blocking Chk2 activity, these inhibitors can enhance the efficacy of cancer therapies, particularly in tumors with deficiencies in DNA repair mechanisms. Chk2 inhibitors have shown promise in preclinical studies by promoting apoptosis in cancer cells and sensitizing them to radiation and chemotherapy. Ongoing research focuses on optimizing these inhibitors for clinical use, aiming to improve treatment outcomes for various cancers, especially those resistant to conventional therapies.
| Catalog Number | R066918 |
| CAS Number | 724708-21-8 |
| Synonyms | SC-203885 |
| Molecular Formula | C15H13N5O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (5Z)-5-(2-amino-4-oxo-1H-imidazol-5-ylidene)-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one |
| InChI | InChI=1S/C15H13N5O2/c16-15-19-11(14(22)20-15)8-5-6-17-13(21)12-10(8)7-3-1-2-4-9(7)18-12/h1-4,18H,5-6H2,(H,17,21)(H3,16,19,20,22)/b11-8- |
| InChIKey | SMPPSGXPGZSJCP-FLIBITNWSA-N |
| SMILES | C1CNC(=O)C2=C(C1=C3C(=O)N=C(N3)N)C4=CC=CC=C4N2 |
