For research use only, not for therapeutic use.
Chlorantraniliprole is an innovative insecticide widely used in agricultural research for its selective action against a broad spectrum of pests. It targets insect muscle function, providing effective pest control with minimal impact on non-target species. This compound is essential for developing sustainable pest management strategies, ensuring precise and reliable results in advanced agronomic studies.
| Catalog Number | R016880 |
| CAS Number | 500008-45-7 |
| Synonyms | Coragen; DKI 0001; DPX-E 2Y45; Dermacor X 100; E 2Y45; Prevathon; Rynaxypyr; 3-Bromo-N-[4-chloro-2-methyl-6-[(methylamino)carbonyl]phenyl]-1-(3-chloro-2-pyridinyl)-1H-pyrazole-5-carboxamide; Acelepryn; Altacor; Altacor 35WG; Altriset; Calteryx; 3-Br |
| Molecular Formula | C18H14BrCl2N5O2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 5-bromo-N-[4-chloro-2-methyl-6-(methylcarbamoyl)phenyl]-2-(3-chloropyridin-2-yl)pyrazole-3-carboxamide |
| InChI | InChI=1S/C18H14BrCl2N5O2/c1-9-6-10(20)7-11(17(27)22-2)15(9)24-18(28)13-8-14(19)25-26(13)16-12(21)4-3-5-23-16/h3-8H,1-2H3,(H,22,27)(H,24,28) |
| InChIKey | PSOVNZZNOMJUBI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1)Cl)C(=O)NC)NC(=O)C2=CC(=NN2C3=C(C=CC=N3)Cl)Br |
