For research use only. Not for therapeutic Use.
Chlorbicyclen(CAT: I024568) is a bicyclic compound containing a chlorine atom, known for its applications in chemical synthesis and pharmaceutical research. Its structure offers unique reactivity, making it valuable as an intermediate in the development of complex organic molecules. Chlorbicyclen has been studied in neurochemical research, particularly for its potential effects on neurotransmitter systems and receptor interactions. Its versatility extends to applications in medicinal chemistry, where it supports the exploration of therapeutic compounds targeting neurological and psychiatric conditions. With its distinct chemical properties, Chlorbicyclen remains a crucial tool for advancing research in drug discovery and organic chemistry.
CAS Number | 2550-75-6 |
Synonyms | Chlorbicyclen; Nodon; AC 12402 |
Molecular Formula | C9H6Cl8 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 1,2,3,4,7,7-hexachloro-5,6-bis(chloromethyl)bicyclo[2.2.1]hept-2-ene |
InChI | InChI=1S/C9H6Cl8/c10-1-3-4(2-11)8(15)6(13)5(12)7(3,14)9(8,16)17/h3-4H,1-2H2 |
InChIKey | FUZORIOHZSVKAW-UHFFFAOYSA-N |
SMILES | ClCC1C(CCl)C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |