Chlordane（Cat No.:R069335）is a chlorinated hydrocarbon that was widely used as an insecticide to control termites and as a broad-spectrum pesticide on crops. It is a mixture of over 140 different compounds, primarily consisting of cis- and trans-chlordane, known for their long-lasting effectiveness. Due to concerns about environmental persistence and potential health risks, including carcinogenicity and neurotoxicity, chlordane was banned in the United States in 1988 and subsequently restricted under the Stockholm Convention on Persistent Organic Pollutants. However, residues can still be found in soil and older constructions.
| Catalog Number | R069335 |
| CAS Number | 57-74-9 |
| Synonyms | Octachloro-hexahydro-methano-1H-indene |
| Molecular Formula | C10-H6-Cl8 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene |
| InChI | InChI=1S/C10H6Cl8/c11-3-1-2-4(5(3)12)9(16)7(14)6(13)8(2,15)10(9,17)18/h2-5H,1H2 |
| InChIKey | BIWJNBZANLAXMG-UHFFFAOYSA-N |
| SMILES | C1C2C(C(C1Cl)Cl)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
