For research use only. Not for therapeutic Use.
Chlorendic acid (HET acid) can be used as a diacid component for the synthesis of oligoesters with potential flame retardant properties with aliphatic diols. Degradation by chlorine radicals may be responsible for the flame retardancy of HET acid-based oligoesters[1].
| Catalog Number | M068181 |
| CAS Number | 115-28-6 |
| Synonyms | (1R,3R)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| Molecular Formula | C9H4Cl6O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C9H4Cl6O4/c10-3-4(11)8(13)2(6(18)19)1(5(16)17)7(3,12)9(8,14)15/h1-2H,(H,16,17)(H,18,19)/t1-,2?,7?,8-/m1/s1 |
| InChIKey | DJKGDNKYTKCJKD-FRSGZLMNSA-N |
| SMILES | C1(C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)O)C(=O)O |
