For research use only. Not for therapeutic Use.
Chlorendic Acid (Cat No.: M068181) is a halogenated dicarboxylic acid widely used in material chemistry, particularly as a flame retardant and corrosion-resistant additive in polymers, resins, and coatings. Its high thermal stability and chemical resistance make it valuable in the production of fire-resistant plastics, epoxy resins, and fiberglass composites. Additionally, it is studied in environmental chemistry due to its persistence and potential ecological impact. Chlorendic Acid plays a crucial role in industrial applications where enhanced durability and flame retardancy are required.
CAS Number | 115-28-6 |
Synonyms | (1R,3R)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
Molecular Formula | C9H4Cl6O4 |
Purity | ≥95% |
InChI | InChI=1S/C9H4Cl6O4/c10-3-4(11)8(13)2(6(18)19)1(5(16)17)7(3,12)9(8,14)15/h1-2H,(H,16,17)(H,18,19)/t1-,2?,7?,8-/m1/s1 |
InChIKey | DJKGDNKYTKCJKD-FRSGZLMNSA-N |
SMILES | C1(C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)O)C(=O)O |