For research use only. Not for therapeutic Use.
Chlorindanol(Cat No.:I001768)is a synthetic compound with antiseptic and antifungal properties, often used in topical treatments to combat skin infections. It is a derivative of indanols and is known for its effectiveness in inhibiting the growth of fungi and certain bacteria, making it valuable for managing superficial skin conditions. Chlorindanol is also studied for its potential applications in preserving cosmetic and pharmaceutical products due to its antimicrobial activity. Its safety profile and efficacy in reducing microbial growth make it a useful agent in dermatological and hygiene-related formulations.
CAS Number | 145-94-8 |
Molecular Formula | C9H9ClO |
Purity | ≥95% |
Target | Bacterial |
Solubility | 10 mM in DMSO |
Storage | Store at RT |
IUPAC Name | 7-chloro-2,3-dihydro-1H-inden-4-ol |
InChI | InChI=1S/C9H9ClO/c10-8-4-5-9(11)7-3-1-2-6(7)8/h4-5,11H,1-3H2 |
InChIKey | ATAJVFBUUIBIEO-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CC(=C2C1)Cl)O |
Reference | <p style=/line-height:25px/> |