For research use only. Not for therapeutic Use.
Chlormidazole Hydrochloride(CAT: I006106) is a synthetic imidazole derivative known for its antifungal properties. It functions by inhibiting ergosterol synthesis, a critical component of fungal cell membranes, leading to impaired cell membrane integrity and fungal cell death. This compound is widely utilized in microbiological and pharmaceutical research to study antifungal mechanisms and fungal physiology. Chlormidazole Hydrochloride is also valuable in exploring the development of novel antifungal therapies, particularly for infections caused by Candida and other pathogenic fungi. Its high purity and effectiveness make it a reliable tool for advancing research in antifungal drug discovery and fungal biology.
CAS Number | 54118-67-1(HCl) |
Synonyms | Chlormidazole Hydrochloride; H115; H 115; H-115; Myco-polycid; Futrican hydrochloride; Fungo-polycid;1-(4-chlorobenzyl)-2-methyl-1H-benzo[d]imidazole hydrochloride |
Molecular Formula | C15H14Cl2N2 |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | 0 - 4°C for short term ,or -20 °C for long term |
IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methylbenzimidazole;hydrochloride |
InChI | InChI=1S/C15H13ClN2.ClH/c1-11-17-14-4-2-3-5-15(14)18(11)10-12-6-8-13(16)9-7-12;/h2-9H,10H2,1H3;1H |
InChIKey | MHMTXDMLQZHXRZ-UHFFFAOYSA-N |
SMILES | CC1=NC2=CC=CC=C2N1CC3=CC=C(C=C3)Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |