For research use only. Not for therapeutic Use.
Chloro[3-(dimethylamino)propyl]magnesium(Cat No.:M082451), is a Grignard reagent commonly used in organic synthesis. It is prepared by reacting magnesium metal with 3-(dimethylamino)propyl chloride. This organomagnesium compound serves as a nucleophile, reacting with various electrophiles to form new carbon-carbon bonds. Its unique structure incorporates both a magnesium atom and a tertiary amine functionality, making it valuable for creating complex organic molecules. Chloro[3-(dimethylamino)propyl]magnesium is often used in the formation of C-C and C-N bonds, allowing chemists to design and synthesize intricate molecular architectures for pharmaceuticals, agrochemicals, and materials.
CAS Number | 19070-16-7 |
Synonyms | CHLORO[3-(DIMETHYLAMINO)PROPYL]MAGNESIUM |
Molecular Formula | C5H12ClMgN |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | magnesium;N,N-dimethylpropan-1-amine;chloride |
InChI | InChI=1S/C5H12N.ClH.Mg/c1-4-5-6(2)3;;/h1,4-5H2,2-3H3;1H;/q-1;;+2/p-1 |
InChIKey | NGPAITITALWALP-UHFFFAOYSA-M |
SMILES | CN(C)CC[CH2-].[Mg+2].[Cl-] |