Chloroacetic-1-13C Acid is an isotopically labeled form of chloroacetic acid, where the carbon atom in the carboxyl group is enriched with the stable carbon-13 isotope. This compound is widely used in chemical and biochemical research, particularly in studying reaction mechanisms, metabolic pathways, and isotopic labeling experiments. The 13C labeling allows for precise detection and analysis in NMR spectroscopy and mass spectrometry, making it a valuable tool for tracing the behavior of chloroacetic acid in various chemical processes. Researchers employ Chloroacetic-1-13C Acid to gain detailed insights into the compound’s role in organic synthesis, enzymatic reactions, and its interactions with biological molecules, contributing to advancements in fields like organic chemistry and biochemistry.
| Catalog Number | M121471 |
| CAS Number | 1681-52-3 |
| Molecular Formula | C2H3ClO2 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2-chloroacetic acid |
| InChI | InChI=1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5)/i2+1 |
| InChIKey | FOCAUTSVDIKZOP-VQEHIDDOSA-N |
| SMILES | C([13C](=O)O)Cl |
