For research use only. Not for therapeutic Use.
Chloroacetyl-d2 Chloride is a deuterated form of chloroacetyl chloride, where two hydrogen atoms are replaced with deuterium. This compound is used in organic synthesis as a reagent for introducing the chloroacetyl group into molecules. The deuterium labeling allows for precise tracking in chemical reactions and studies involving mass spectrometry or NMR spectroscopy, making it valuable for research in reaction mechanisms, metabolic studies, and isotopic labeling experiments. The distinct isotopic signature aids in the detailed analysis of the compound’s behavior and interactions in various chemical processes.
CAS Number | 159301-43-6 |
Synonyms | Chloroacetic Acid-d2 Chloride; Chloroacetic-d2 Chloride; Chloroethanoyl-d2 Chloride; Monochloroacetyl-d2 Chloride; |
Molecular Formula | C2H2Cl2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-chloro-2,2-dideuterioacetyl chloride |
InChI | InChI=1S/C2H2Cl2O/c3-1-2(4)5/h1H2/i1D2 |
InChIKey | VGCXGMAHQTYDJK-DICFDUPASA-N |
SMILES | C(C(=O)Cl)Cl |