For research use only. Not for therapeutic Use.
Chlorobutanol（Cat No.:M047832）is a chlorinated alcohol compound widely used as a preservative and antimicrobial agent in pharmaceutical formulations, including eye drops, nasal sprays, and injectables. Its effectiveness in preventing microbial growth and prolonging the shelf life of products makes it a valuable ingredient in various medical and cosmetic applications. Beyond its preservative role, Chlorobutanol also exhibits mild anesthetic and sedative properties, contributing to its use in topical and parenteral preparations. Its stability and broad-spectrum antimicrobial activity make it essential in pharmaceutical manufacturing and product development.
| Catalog Number | M047832 |
| CAS Number | 1320-66-7 |
| Molecular Formula | C4H9ClO |
| Purity | ≥95% |
| IUPAC Name | 1-chlorobutan-1-ol |
| InChI | InChI=1S/C4H9ClO/c1-2-3-4(5)6/h4,6H,2-3H2,1H3 |
| InChIKey | LVZIWKFQFKNSMO-UHFFFAOYSA-N |
| SMILES | CCCC(O)Cl |
