For research use only. Not for therapeutic Use.
Chlorocarbonylsulfenyl chloride (Cat No.:C000936) is an organosulfur compound. It is a colorless to pale yellow liquid and belongs to the family of sulfenyl chlorides. This compound is used as a reagent and intermediate in organic synthesis, particularly in the preparation of various chemical compounds. It contains both a carbonyl and a sulfenyl chloride functional group, making it valuable in various chemical reactions to form different derivatives.
| CAS Number | 2757-23-5 |
| Synonyms | (Chlorocarbonyl)sulfenyl Chloride; (Chloroformyl)sulfur Chloride; |
| Molecular Formula | CCl₂OS |
| Purity | ≥95% |
| Solubility | Acetonitrile (Slightly), Chloroform (Sparingly) |
| Appearance | Colourless to Pale Yellow Oil |
| Storage | 2-8°C, Inert atmosphere |
| IUPAC Name | S-chloro chloromethanethioate |
| InChI | InChI=1S/CCl2OS/c2-1(4)5-3 |
| InChIKey | MNOALXGAYUJNKX-UHFFFAOYSA-N |
| SMILES | C(=O)(SCl)Cl |
| Reference | Sorra, K., et al.: Int. J. Mol. Sci., 15, 16500 (2014); Gurjar, A. S., et al.: Bioorg. Chem., 57, 90 (2014); Enache, L., et al.: e-EROS Encyclopedia of Reagents for Organic Synthesis, 1 (2005) |
