For research use only. Not for therapeutic Use.
Chlorodifluoro-acetic Acid Sodium Salt(CAT: R051283) is a chemical compound used in various industrial applications. Its mode of action involves acting as a sodium salt of chlorodifluoroacetic acid, and its unique chemical properties make it useful in several processes. This compound finds application as a precursor in the synthesis of fluorinated compounds and in the production of certain specialty chemicals. Additionally, it can be utilized in the manufacturing of pharmaceuticals and agrochemicals.
CAS Number | 1895-39-2 |
Synonyms | 2-Chloro-2,2-difluoro-acetic Acid Sodium Salt; Chlorodifluoroacetic Acid Sodium Salt; Sodium Chlorodifluoroacetate; Sodium Difluorochloroacetate |
Molecular Formula | C2ClF2NaO2 |
Purity | ≥95% |
Storage | -20℃ |
IUPAC Name | sodium;2-chloro-2,2-difluoroacetate |
InChI | InChI=1S/C2HClF2O2.Na/c3-2(4,5)1(6)7;/h(H,6,7);/q;+1/p-1 |
InChIKey | MRTAVLDNYYEJHK-UHFFFAOYSA-M |
SMILES | C(=O)(C(F)(F)Cl)[O-].[Na+] |