For research use only. Not for therapeutic Use.
Chloromethyl acetate(Cat No.:R026626), is a chemical compound used in organic synthesis. It is a reactive compound that contains both a chloromethyl group and an acetate group. This compound is commonly employed as a reagent in the introduction of chloromethyl functionality into various molecules. It serves as a precursor in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its ability to form covalent bonds with other molecules makes it valuable in creating complex structures.
CAS Number | 625-56-9 |
Synonyms | Chloromethanol Acetate; (Acetyloxy)methyl Chloride; Acetic Acid Chloromethyl Ester?Acetoxymethyl Chloride; |
Molecular Formula | C3H5ClO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | chloromethyl acetate |
InChI | InChI=1S/C3H5ClO2/c1-3(5)6-2-4/h2H2,1H3 |
InChIKey | SMJYMSAPPGLBAR-UHFFFAOYSA-N |
SMILES | CC(=O)OCCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |