For research use only. Not for therapeutic Use.
Chlorophenesin（Cat No.:R055603）is a synthetic compound widely used in cosmetics and pharmaceuticals for its antimicrobial and muscle-relaxant properties. It acts as a preservative, preventing bacterial and fungal contamination in skin care products, enhancing product safety and longevity. Additionally, it has muscle relaxant qualities, commonly applied in topical formulations to relieve muscle discomfort and spasms. Chlorophenesin is favored for its stability and effectiveness at low concentrations, making it suitable for a variety of formulations aimed at enhancing skin health and comfort.
| Catalog Number | R055603 |
| CAS Number | 104-29-0 |
| Synonyms | (±)-p-Chlorphenesin; 3-(p-Chlorophenoxy)propane-1,2-diol; Adermykon; Chlorphenesin; Demykon; Elestab CPN; Gecophen; Glycerol α-p-chlorophenyl ether; Mycil; NSC 6401; p-Chlorophenyl glyceryl ether; p-Chlorophenyl-α-glyceryl ether; p-Chlorphenesin; |
| Molecular Formula | C9H11ClO3 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Desiccate at RT |
| IUPAC Name | 3-(4-chlorophenoxy)propane-1,2-diol |
| InChI | InChI=1S/C9H11ClO3/c10-7-1-3-9(4-2-7)13-6-8(12)5-11/h1-4,8,11-12H,5-6H2 |
| InChIKey | MXOAEAUPQDYUQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(CO)O)Cl |
