For research use only. Not for therapeutic Use.
Chloropheniramine-d4(Cat No.:M071488), is a deuterium-labeled derivative of chloropheniramine, an antihistamine medication used to alleviate allergy symptoms. By substituting some hydrogen atoms with deuterium atoms, it becomes a stable isotopic standard used in research and pharmacological studies. Chloropheniramine-d4 has the same chemical structure as the non-labeled compound but can be distinguished and measured accurately using analytical techniques like mass spectrometry.
Catalog Number | M071488 |
CAS Number | 132-22-9 |
Synonyms | Chloropheniramine-D4 |
Molecular Formula | C16H19ClN2 |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20 °C |
IUPAC Name | 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine |
InChI | InChI=1S/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
InChIKey | SOYKEARSMXGVTM-UHFFFAOYSA-N |
SMILES | CN(C)CCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2 |