For research use only, not for therapeutic use.
Chloroquine Sulfate(CAT: R023033) is a sulfate form of chloroquine. It is an anti-malarial drug, with anti-inflammatory and analgesic, anti-infection, and immune regulation effects, generally used in the treatment of rheumatoid arthritis, lupus erythematosus, and other diseases. This product is used for medical research and development and other scientific research purposes.
| Catalog Number | R023033 |
| CAS Number | 132-73-0 |
| Synonyms | Melubrin; 7-Chloro-4-[[4-(diethylamino)-1-methylbutyl]amino]quinoline Sulfate; 7-Chloro-4-(4’-diethylamino-1-methylbutylamino)quinoline Sulfate; Chloroquine Sulfate; Chlorquine Sulfate; Ciplaquin; Lariago; Melubrine; NSC 292296; Nivaquine; Resochine |
| Molecular Formula | C18H28ClN3O4S |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;sulfuric acid |
| InChI | InChI=1S/C18H26ClN3.H2O4S/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;1-5(2,3)4/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);(H2,1,2,3,4) |
| InChIKey | OJPWHUOVKVKBQB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OS(=O)(=O)O |
