For research use only, not for therapeutic use.
Chlorotoluron (Cat. No: R050651) is a selective internal absorption and conduction type urea herbicide, which is mainly absorbed by the root system of weeds and has leaf contact killing effect. It is an inhibitor of electron transport in weed photosynthesis, which makes weeds starve and die.
| Catalog Number | R050651 |
| CAS Number | 15545-48-9 |
| Synonyms | N’-(3-Chloro-4-methylphenyl)-N,N-dimethyl-urea; 1,1-Dimethyl-3-(3-chloro-4-?methylphenyl)urea; 1-(3-Chloro-4-methyl)-3,3-dimethylurea; 3-(3-Chloro-p-tolyl)-1,1-dimethylurea; Dicuran; Dicuran 500FL; Lentipur Flo; Lentipur Forte; N,N-Dimethyl-N’-(3-chl |
| Molecular Formula | C10H13ClN2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1,1-dimethylurea |
| InChI | InChI=1S/C10H13ClN2O/c1-7-4-5-8(6-9(7)11)12-10(14)13(2)3/h4-6H,1-3H3,(H,12,14) |
| InChIKey | JXCGFZXSOMJFOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)N(C)C)Cl |
