For research use only. Not for therapeutic Use.
Chlorphenoxamine (Cat.No:I004847), also known as chlorphenoxamine hydrochloride, is an antihistamine medication. It is primarily used to treat symptoms associated with allergies, such as sneezing, itching, and watery eyes. Chlorphenoxamine works by blocking the action of histamine, a substance in the body that causes allergic reactions.
| Catalog Number | I004847 |
| CAS Number | 77-38-3 |
| Molecular Formula | C18H22ClNO |
| Purity | ≥95% |
| Target | Histamine Receptor |
| Solubility | DMSO: ≥ 48 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N,N-dimethylethanamine |
| InChI | InChI=1S/C18H22ClNO/c1-18(21-14-13-20(2)3,15-7-5-4-6-8-15)16-9-11-17(19)12-10-16/h4-12H,13-14H2,1-3H3 |
| InChIKey | KKHPNPMTPORSQE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCCN(C)C |
| Reference | <p style=/line-height:25px/> |
