For research use only. Not for therapeutic Use.
Chlorprothixene hydrochloride（Cat No.:R012205） is a potent dopamine and histamine receptor antagonist that binds to human D1, D2, D3, D5, and H1 receptors with high affinity, indicated by Ki values of 18 nM, 2.96 nM, 4.56 nM, 9 nM, and 3.75 nM, respectively. Due to its interactions with these receptors, it exhibits antipsychotic effects. This compound’s ability to block dopamine and histamine receptors makes it valuable in managing psychotic disorders and related conditions, providing relief from symptoms such as hallucinations and delusions.
| Catalog Number | R012205 |
| CAS Number | 6469-93-8 |
| Synonyms | (3Z)-3-(2-Chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-1-propanamine Hydrochloride; Truxal Hydrochloride; cis-Chlorprothixene Hydrochloride; Taractan; Truxal; |
| Molecular Formula | C18H18ClNS • HCl |
| Purity | ≥95% |
| Target | Dopamine Receptor |
| Solubility | Soluble in DMSO |
| Storage | Store at 2-8°C |
| IUPAC Name | (3Z)-3-(2-chlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine;hydrochloride |
| InChI | InChI=1S/C18H18ClNS.ClH/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18;/h3-4,6-10,12H,5,11H2,1-2H3;1H/b14-7-; |
| InChIKey | YWKRLOSRDGPEJR-KIUKIJHYSA-N |
| SMILES | CN(C)CCC=C1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl.Cl |
