Cholesterol-13C2 is a high-purity isotopically labeled compound essential for advanced pharmaceutical research. This version of Cholesterol incorporates two carbon-13 atoms, making it a critical tool for studies on lipid metabolism, cardiovascular health, and steroid biosynthesis. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of pharmacokinetic and metabolic pathway studies. With improved stability and consistency, Cholesterol-13C2 integrates seamlessly into various experimental protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Ideal for research and development, it supports the advancement of safer and more effective therapeutic agents.
| Catalog Number | S000804 |
| CAS Number | 78887-48-6 |
| Molecular Formula | C2513C2H46O |
| Purity | 95% |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1/i17+1,21+1 |
| InChIKey | HVYWMOMLDIMFJA-WKKCFSIESA-N |
| SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[13C@@H]([13CH2]4)O)C)C |
