For research use only. Not for therapeutic Use.
Cholic acid-d4(Cat No.:S000785) is a specialized form of cholic acid, a primary bile acid crucial for lipid digestion and absorption. The “d4” designation indicates that four hydrogen atoms in the cholic acid molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of cholic acid metabolism and its incorporation into bile acid pathways using advanced analytical techniques like mass spectrometry. Cholic acid-d4 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating disorders related to bile acid metabolism, such as cholestatic liver diseases.
CAS Number | 116380-66-6 |
Molecular Formula | C24H36D4O5 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-2,2,4,4-tetradeuterio-3,7,12-trihydroxy-10,13-dimethyl-3,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
InChI | InChI=1S/C24H40O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,15-,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1/i8D2,10D2 |
InChIKey | BHQCQFFYRZLCQQ-YFEOEUIKSA-N |
SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |