For research use only. Not for therapeutic Use.
Chroman-5,7-diol(CAT: L000297) is a compound with applications in material and organic chemistry. This chemical is utilized in the synthesis of organic compounds and materials. Its action method involves serving as a building block for the creation of various organic molecules and materials. In material chemistry, it plays a role in the preparation of specialized materials, often used in the development of advanced materials for various applications.
CAS Number | 543710-46-9 |
Molecular Formula | C9H10O3 |
Purity | ≥95% |
IUPAC Name | 3,4-dihydro-2H-chromene-5,7-diol |
InChI | InChI=1S/C9H10O3/c10-6-4-8(11)7-2-1-3-12-9(7)5-6/h4-5,10-11H,1-3H2 |
InChIKey | VYUSVRQMDKOTPS-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |