For research use only. Not for therapeutic Use.
Chromane-2-carboxylic Acid (Cat.No:R015731) is a chemical compound known for its structural resemblance to chromane, a type of organic compound with a bicyclic structure. It has potential applications in medicinal chemistry and drug development due to its unique structural features, which may influence biological activity.
Catalog Number | R015731 |
CAS Number | 51939-71-0 |
Synonyms | 2-Chromancarboxylic Acid; (±)-2-Chromancarboxylic Acid; 3,4-Dihydro-1-benzopyran-2-carboxylic Acid; 3,4-Dihydro-2H-1-benzopyran-2-carboxylic Acid |
Molecular Formula | C10H10O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,4-dihydro-2H-chromene-2-carboxylic acid |
InChI | InChI=1S/C10H10O3/c11-10(12)9-6-5-7-3-1-2-4-8(7)13-9/h1-4,9H,5-6H2,(H,11,12) |
InChIKey | SFLFCQJQOIZMHF-UHFFFAOYSA-N |
SMILES | C1CC2=CC=CC=C2OC1C(=O)O |