For research use only. Not for therapeutic Use.
Chromoionophore XI, ETH 7061(Cat No.:M113974)is a highly selective ionophore used in chemical sensors and analytical chemistry for ion detection and quantification. This compound exhibits exceptional sensitivity to specific ions, making it ideal for developing ion-selective electrodes and optodes. ETH 7061’s robust chemical stability ensures reliable performance in various environmental conditions. Its applications extend to biomedical diagnostics, environmental monitoring, and industrial process control. As a critical component in ion-selective technologies, Chromoionophore XI, ETH 7061, enhances analytical precision and contributes to advancements in chemical sensing methodologies.
Catalog Number | M113974 |
CAS Number | 138833-46-2 |
Synonyms | Fluorescein octadecyl ester; octadecyl 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate. |
Molecular Formula | C38H48O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | octadecyl 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate |
InChI | InChI=1S/C38H48O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-26-42-38(41)32-21-18-17-20-31(32)37-33-24-22-29(39)27-35(33)43-36-28-30(40)23-25-34(36)37/h17-18,20-25,27-28,39H,2-16,19,26H2,1H3 |
InChIKey | UDHKRSZNYLYOEP-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCCOC(=O)C1=CC=CC=C1C2=C3C=CC(=O)C=C3OC4=C2C=CC(=C4)O |