For research use only. Not for therapeutic Use.
Chrysoeriol-d3(Cat No.:R054396) is a high-purity, deuterium-labeled compound essential for advanced pharmaceutical and biochemical research. Featuring three deuterium atoms, this isotopically labeled version of Chrysoeriol is crucial for studies on flavonoid metabolism, antioxidant activity, and cellular signaling pathways. Chrysoeriol-d3 aids in the development of therapeutic agents and enhances the understanding of the biological roles and mechanisms of flavonoids, making it a valuable tool for scientific investigations.
Catalog Number | R054396 |
CAS Number | 1794941-48-2 |
Synonyms | 5,7-Dihydroxy-2-[4-hydroxy-3-(methoxy-d3)phenyl]-4H-1-benzopyran-4-one; 4’,5,7-Trihydroxy-3’-(methoxy-d3)flavone; 3’-(Methoxy-d3)-4’,5,7-trihydroxyflavone; 3’-(Methoxy-d3)apigenin; 3’-O-(Methyl-d3)luteolin; 5,7,4’-Trihydroxy-3’-(methoxy-d3)flavone; C |
Molecular Formula | C16H12O6 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 5,7-dihydroxy-2-[4-hydroxy-3-(trideuteriomethoxy)phenyl]chromen-4-one |
InChI | InChI=1S/C16H12O6/c1-21-14-4-8(2-3-10(14)18)13-7-12(20)16-11(19)5-9(17)6-15(16)22-13/h2-7,17-19H,1H3/i1D3 |
InChIKey | SCZVLDHREVKTSH-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O |