For research use only. Not for therapeutic Use.
Chrysophanol (CAT: I003696), also known as Chrysophanic acid, is a natural anthraquinone compound. It exhibits inhibitory effects on epidermal growth factor (EGF)-induced phosphorylation of the epidermal growth factor receptor (EGFR). Additionally, Chrysophanol is reported to suppress the activation of the AKT signaling pathway and mTOR/p70S6K pathway. Its ability to modulate these key cellular pathways suggests potential therapeutic applications in conditions related to EGFR signaling dysregulation, such as certain types of cancer. The compound’s mechanisms of action make it an interesting candidate for further exploration in the fields of oncology and targeted therapies.
| Catalog Number | I003696 |
| CAS Number | 481-74-3 |
| Synonyms | Chrysophanic Acid;NSC 37132;NSC 646567;Turkey Rhubarb |
| Molecular Formula | C15H10O4 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO |
| Storage | -20℃ |
| IUPAC Name | 1,8-dihydroxy-3-methylanthracene-9,10-dione |
| InChI | InChI=1S/C15H10O4/c1-7-5-9-13(11(17)6-7)15(19)12-8(14(9)18)3-2-4-10(12)16/h2-6,16-17H,1H3 |
| InChIKey | LQGUBLBATBMXHT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(O)=C1)C(C3=C(O)C=CC=C3C2=O)=O |
