For research use only. Not for therapeutic Use.
C.I. 37510 is a biochemical
| Catalog Number | I024656 |
| CAS Number | 92-78-4 |
| Synonyms | Azoic Coupling Component 10; NSC 50684; NSC50684; NSC-50684 |
| Molecular Formula | C17H12ClNO2 |
| Purity | 98% |
| Target | Histone Acetyltransferase |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-(4-chlorophenyl)-3-hydroxy-2-naphthamide |
| InChI | InChI=1S/C17H12ClNO2/c18-13-5-7-14(8-6-13)19-17(21)15-9-11-3-1-2-4-12(11)10-16(15)20/h1-10,20H,(H,19,21) |
| InChIKey | OHAXNCGNVGGWSO-UHFFFAOYSA-N |
| SMILES | Oc(c1)c(C(Nc2ccc(Cl)cc2)=O)cc3c1cccc3 |
