For research use only. Not for therapeutic Use.
C.I. 37525 is a biochemical
| Catalog Number | I024657 |
| CAS Number | 92-76-2 |
| Synonyms | Acna Naphthol T; C.I. Azoic Coupling Component 8; NSC50686; NSC 50686; NSC-50686 |
| Molecular Formula | C18H14ClNO2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-3-hydroxy-2-naphthamide |
| InChI | InChI=1S/C18H14ClNO2/c1-11-8-14(19)6-7-16(11)20-18(22)15-9-12-4-2-3-5-13(12)10-17(15)21/h2-10,21H,1H3,(H,20,22) |
| InChIKey | PSRNXESQSJEQMN-UHFFFAOYSA-N |
| SMILES | Cc1c(NC(c(c2)c(O)cc3c2cccc3)=O)ccc(Cl)c1 |
