For research use only. Not for therapeutic Use.
Cichoric acid(Cat No.:I004465) is a natural compound that has been reported to possess antioxidative properties. As an antioxidant, it helps neutralize harmful free radicals in the body, reducing oxidative stress and potential damage to cells and tissues. Cichoric acid is found in various plants, including Echinacea purpurea, and is believed to contribute to their therapeutic properties. Its antioxidative activity makes cichoric acid a valuable compound in the field of natural products and is potentially beneficial for human health as a dietary supplement or ingredient in functional foods.
CAS Number | 6537-80-0 |
Molecular Formula | C22H18O12 |
Purity | ≥95% |
Target | NF-κB |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | (2R,3R)-2,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanedioic acid |
InChI | InChI=1S/C22H18O12/c23-13-5-1-11(9-15(13)25)3-7-17(27)33-19(21(29)30)20(22(31)32)34-18(28)8-4-12-2-6-14(24)16(26)10-12/h1-10,19-20,23-26H,(H,29,30)(H,31,32)/b7-3+,8-4+/t19-,20-/m1/s1 |
InChIKey | YDDGKXBLOXEEMN-IABMMNSOSA-N |
SMILES | C1=CC(=C(C=C1C=CC(=O)OC(C(C(=O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)C(=O)O)O)O |