For research use only. Not for therapeutic Use.
Hydroquinone (anthraquinone-1,4-dimethylamino) diethyl ether is a hydrogenated quinine derivative commonly employed as an intermediate in pharmaceutical and organic synthesis. Primarily used in laboratory research and development, as well as chemical and pharmaceutical synthesis processes, it serves as a valuable building block for the production of various bioactive compounds. Its diverse structure and reactivity make it an essential component in the synthesis of pharmaceutical intermediates and enable exploration in drug development and other scientific investigations.
Catalog Number | L028864 |
CAS Number | 176097-24-8 |
Molecular Formula | C54H56N4O6 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1,4-bis[(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methoxy]anthracene-9,10-dione |
InChI | InChI=1S/C54H56N4O6/c1-5-31-29-57-23-19-33(31)25-45(57)53(39-17-21-55-43-13-11-35(61-3)27-41(39)43)63-47-15-16-48(50-49(47)51(59)37-9-7-8-10-38(37)52(50)60)64-54(46-26-34-20-24-58(46)30-32(34)6-2)40-18-22-56-44-14-12-36(62-4)28-42(40)44/h7-18,21-22,27-28,31-34,45-46,53-54H,5-6,19-20,23-26,29-30H2,1-4H3/t31-,32-,33-,34-,45-,46-,53+,54+/m0/s1 |
InChIKey | ARCFYUDCVYJQRN-KESJXZTCSA-N |
SMILES | CCC1CN2CCC1CC2C(C3=C4C=C(C=CC4=NC=C3)OC)OC5=C6C(=C(C=C5)OC(C7CC8CCN7CC8CC)C9=C1C=C(C=CC1=NC=C9)OC)C(=O)C1=CC=CC=C1C6=O |