CID-2011756 (Cat.No:I004410) is a small molecule inhibitor that targets the p38 MAP kinase pathway. It has been studied for its potential therapeutic applications in various diseases, including inflammation, cancer, and neurodegenerative disorders. CID-2011756 selectively inhibits the activity of p38α and p38β isoforms, which are involved in cellular signaling pathways associated with inflammation and stress response. Preclinical studies have shown promising results, making CID-2011756 a potential candidate for further development as a therapeutic agent.
| Catalog Number | I004410 |
| CAS Number | 638156-11-3 |
| Synonyms | 5-(3-chlorophenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]furan-2-carboxamide |
| Molecular Formula | C₂₂H₂₁ClN₂O₃ |
| Purity | ≥95% |
| Target | Protein Ser/Thr Phosphatases |
| Solubility | DMSO: 50 mM |
| Storage | Store at RT |
| IC50 | 10±0.7 uM (cellular inhibition of phospho-Ser916-PKD1 activity) [1] |
| IUPAC Name | 5-(3-chlorophenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]furan-2-carboxamide |
| InChI | nChI=1S/C22H21ClN2O3/c23-18-3-1-2-17(14-18)20-8-9-21(28-20)22(26)24-19-6-4-16(5-7-19)15-25-10-12-27-13-11-25/h1-9,14H,10-13,15H2,(H,24,26) |
| InChIKey | XQJWTJLJEYIUDZ-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC=C(C=C2)NC(=O)C3=CC=C(O3)C4=CC(=CC=C4)Cl |
| Reference | <p style=/line-height:25px/> |
