For research use only. Not for therapeutic Use.
CID-697851 (CAT: I012720) is a small molecule compound that has been identified as a potent and selective inhibitor of the Janus kinase 2 (JAK2) enzyme. JAK2 is a tyrosine kinase involved in signal transduction pathways mediated by cytokine receptors. Inhibition of JAK2 can modulate the activity of downstream signaling pathways, such as the JAK-STAT pathway, which plays a critical role in cell growth, differentiation, and immune responses. CID-697851 has shown promising results in preclinical studies as a potential therapeutic agent for the treatment of JAK2-driven diseases, including myeloproliferative neoplasms and certain types of leukemia.
| Catalog Number | I012720 |
| CAS Number | 312508-42-2 |
| Synonyms | N-(3-Cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyrazine-2-carboxamide |
| Molecular Formula | C14H12N4OS |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyrazine-2-carboxamide |
| InChI | InChI=1S/C14H12N4OS/c15-7-10-9-3-1-2-4-12(9)20-14(10)18-13(19)11-8-16-5-6-17-11/h5-6,8H,1-4H2,(H,18,19) |
| InChIKey | BEAKIQPRTWAVNZ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3=NC=CN=C3)C#N |
