For research use only. Not for therapeutic Use.
CID16197121 is a high-purity chemical compound essential for advanced pharmaceutical and biochemical research. This compound is crucial for studying metabolic pathways, enzyme interactions, and drug development processes. It offers precise and reliable analytical results due to its exceptional purity and stability. Ideal for synthetic chemistry and pharmacological studies, CID16197121 integrates seamlessly into existing research protocols, providing a robust and cost-effective solution for high-precision scientific investigations. Enhance your research accuracy and outcomes with the reliable and versatile CID16197121.
| Catalog Number | I006128 |
| CAS Number | 958941-95-2 |
| Synonyms | CID16197121; CID 16197121; CID-16197121.;(4R,5S,6S)-4-(1-benzothiophen-3-yl)-6-ethoxy-5-(3-hydroxypropyl)-N-phenyl-5,6-dihydro-4H-pyran-2-carboxamide |
| Molecular Formula | C25H27NO4S |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| InChI | InChI=1S/C25H27NO4S/c1-2-29-25-19(12-8-14-27)20(21-16-31-23-13-7-6-11-18(21)23)15-22(30-25)24(28)26-17-9-4-3-5-10-17/h3-7,9-11,13,15-16,19-20,25,27H,2,8,12,14H2,1H3,(H,26,28)/t19-,20+,25-/m0/s1 |
| InChIKey | DPIFUIZFNOZKRB-DFIYOIEZSA-N |
| SMILES | O=C(C1=C[C@@H](C2=CSC3=CC=CC=C23)[C@H](CCCO)[C@@H](OCC)O1)NC4=CC=CC=C4 |
