For research use only. Not for therapeutic Use.
CIL56 is a small molecule known for its ability to induce lysosomal cell death through its impact on lysosomal function and autophagic pathways. By disrupting lysosomal integrity, CIL56 triggers apoptosis, making it a valuable tool in cancer research and studies on cellular homeostasis. Its unique mechanism of targeting lysosomes sets it apart as a compound of interest for exploring therapeutic strategies in cancer and other diseases associated with lysosomal dysfunction. CIL56 offers significant insights into autophagy and cell death mechanisms.
| Catalog Number | I011853 |
| CAS Number | 300802-28-2 |
| Synonyms | CA3; 2,7-bis(1-piperidinylsulfonyl)-9H-fluoren-9-one, oxime |
| Molecular Formula | C23H27N3O5S2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-[2,7-bis(piperidin-1-ylsulfonyl)fluoren-9-ylidene]hydroxylamine |
| InChI | InChI=1S/C23H27N3O5S2/c27-24-23-21-15-17(32(28,29)25-11-3-1-4-12-25)7-9-19(21)20-10-8-18(16-22(20)23)33(30,31)26-13-5-2-6-14-26/h7-10,15-16,27H,1-6,11-14H2 |
| InChIKey | XYZXEEIUKQGUHB-UHFFFAOYSA-N |
| SMILES | O=S(C1=CC2=C(C=C1)C3=CC=C(S(N4CCCCC4)(=O)=O)C=C3/C2=NO)(N5CCCCC5)=O |
