For research use only. Not for therapeutic Use.
Cilnidipine, also known as FRC-8653, is a calcium channel blocker. Cilnidipine is the novel calcium antagonist accompanied with L-type and N-type calcium channel blocking function. It was approved in 1995. Compared with other calcium antagonists, cilnidipine can act on the N-type calcium channel that existing sympathetic nerve end besides acting on L-type calcium channel that similar to most of the calcium antagonists.
| Catalog Number | A000275 |
| CAS Number | 132203-70-4 |
| Synonyms | 132203-70-4; Cinalong; Atelec; Siscard; FRC 8653 |
| Molecular Formula | C27H28N2O7 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >24.6mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | 1S/C27H28N2O7/c1-18-23(26(30)35-14-8-11-20-9-5-4-6-10-20)25(21-12-7-13-22(17-21)29(32)33)24(19(2)28-18)27(31)36-16-15-34-3/h4-13,17,25,28H,14-16H2,1-3H3/b11-8+ |
| InChIKey | KJEBULYHNRNJTE-DHZHZOJOSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCC=CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC |
