For research use only. Not for therapeutic Use.
Cilobradine(CAT: I002399) is a hyperpolarization-activated cyclic nucleotide-gated (HCN) channel blocker that functions as an open-channel blocker of both neuronal Ih and cardiac If channels. By modulating these ion channels, Cilobradine reduces pacemaker current activity, leading to slowed heart rate and reduced neuronal excitability. This mechanism makes it particularly useful in cardiovascular and neurological research, where it is studied for its potential in treating conditions such as bradycardia, arrhythmias, and neuropathic pain. Its selectivity for HCN channels provides a valuable tool for investigating the physiological and pathological roles of Ih and If currents in both cardiac and neuronal systems.
| Catalog Number | I002399 |
| CAS Number | 186097-54-1 |
| Synonyms | Cilobradine |
| Molecular Formula | C28H38N2O5 • HCl |
| Purity | ≥95% |
| Target | HCN Channel |
| Solubility | 10 mM in H2O |
| Storage | -20°C |
| IUPAC Name | 3-[[(3S)-1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-3-yl]methyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one;hydrochloride |
| InChI | InChI=1S/C28H38N2O5.ClH/c1-32-24-8-7-20(14-25(24)33-2)9-12-29-11-5-6-21(18-29)19-30-13-10-22-15-26(34-3)27(35-4)16-23(22)17-28(30)31;/h7-8,14-16,21H,5-6,9-13,17-19H2,1-4H3;1H/t21-;/m0./s1 |
| InChIKey | MTAKUIYCCYKGJJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCN2CCC[C@@H](C2)CN3CCC4=CC(=C(C=C4CC3=O)OC)OC)OC.Cl |
