For research use only. Not for therapeutic Use.
Cilofexor is a potent（Cat No.:I001899), selective agonist of the farnesoid X receptor (FXR), primarily investigated for its potential in treating liver diseases such as nonalcoholic steatohepatitis (NASH) and primary biliary cholangitis (PBC). By activating FXR, Cilofexor reduces liver inflammation, fibrosis, and bile acid synthesis, promoting improved liver function and health. This novel therapeutic agent offers promise in addressing unmet needs in chronic liver conditions, making it a valuable asset in hepatology research. Cilofexor’s efficacy and safety profile support its role in advancing liver disease treatment strategies.
| Catalog Number | I001899 |
| CAS Number | 1418274-28-8 |
| Synonyms | 2-[3-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]-3-hydroxyazetidin-1-yl]pyridine-4-carboxylic acid |
| Molecular Formula | C28H22Cl3N3O5 |
| Purity | ≥95% |
| IUPAC Name | 2-[3-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]-3-hydroxyazetidin-1-yl]pyridine-4-carboxylic acid |
| InChI | InChI=1S/C28H22Cl3N3O5/c29-20-2-1-3-21(30)24(20)25-18(26(39-33-25)15-4-5-15)12-38-17-6-7-19(22(31)11-17)28(37)13-34(14-28)23-10-16(27(35)36)8-9-32-23/h1-3,6-11,15,37H,4-5,12-14H2,(H,35,36) |
| InChIKey | KZSKGLFYQAYZCO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=NO2)C3=C(C=CC=C3Cl)Cl)COC4=CC(=C(C=C4)C5(CN(C5)C6=NC=CC(=C6)C(=O)O)O)Cl |
