For research use only. Not for therapeutic Use.
Cimetidine-d3 is a deuterated form of cimetidine, featuring three deuterium atoms. This high-purity compound is essential for advanced pharmaceutical and biochemical research, particularly in studying the pharmacokinetics, metabolic pathways, and drug interactions of cimetidine. Its stable isotope labeling ensures precise and reliable analytical results. Cimetidine-d3 is ideal for research on histamine H2-receptor antagonists and gastrointestinal treatments, providing a robust and consistent tool for high-precision scientific investigations, seamlessly integrating into existing research protocols.
| Catalog Number | R007043 |
| CAS Number | 1185237-29-9 |
| Synonyms | N-Cyano-N’-methyl-d3-N’’-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]guanidine;?SKF-9233-4-d3; Acibilin-d3; Acinil-d3; Cimal-d3; Cimetag-d3; Cimetum-d3; Edalened3; Peptol-d3; Tagamet-d3; Ulcedin-d3; |
| Molecular Formula | C10H16N6S |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 1-cyano-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-3-(trideuteriomethyl)guanidine |
| InChI | InChI=1S/C10H16N6S/c1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14)/i2D3 |
| InChIKey | AQIXAKUUQRKLND-BMSJAHLVSA-N |
| SMILES | CC1=C(N=CN1)CSCCN=C(NC)NC#N |
