For research use only. Not for therapeutic Use.
Cinaciguat (Cat.No:I003178) is a novel drug that acts as a stimulator of soluble guanylate cyclase (sGC), an enzyme involved in the regulation of nitric oxide signaling. By stimulating sGC, cinaciguat enhances the production of cyclic guanosine monophosphate (cGMP), leading to vasodilation and relaxation of blood vessels. This mechanism of action makes cinaciguat a potential therapeutic option for conditions such as pulmonary hypertension and heart failure. Clinical studies are underway to explore its efficacy and safety in treating these cardiovascular disorders.
| Catalog Number | I003178 |
| CAS Number | 329773-35-5 |
| Synonyms | 4-[[4-carboxybutyl-[2-[2-[[4-(2-phenylethyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| Molecular Formula | C36H39NO5 |
| Purity | ≥95% |
| Target | Guanylate Cyclase |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 4-[[4-carboxybutyl-[2-[2-[[4-(2-phenylethyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| InChI | InChI=1S/C36H39NO5/c38-35(39)12-6-7-24-37(26-30-19-21-33(22-20-30)36(40)41)25-23-32-10-4-5-11-34(32)42-27-31-17-15-29(16-18-31)14-13-28-8-2-1-3-9-28/h1-5,8-11,15-22H,6-7,12-14,23-27H2,(H,38,39)(H,40,41) |
| InChIKey | WPYWMXNXEZFMAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC=C(C=C2)COC3=CC=CC=C3CCN(CCCCC(=O)O)CC4=CC=C(C=C4)C(=O)O |
| Reference | <p style=/line-height:25px/> |
