For research use only. Not for therapeutic Use.
Cinanserin Hydrochloride(Cat No.:I010214)is a serotonin receptor antagonist that specifically inhibits 5-HT2A receptors. It is primarily used in research to explore its role in modulating serotonin-related pathways and its potential therapeutic effects in neurological and psychiatric conditions. By blocking serotonin receptors, Cinanserin Hydrochloride may help reduce symptoms related to serotonin imbalance, such as anxiety and depression. Additionally, it has been investigated for its anti-inflammatory and antiviral properties, making it a versatile compound in both pharmaceutical and biochemical research for exploring treatments in various disease models.
CAS Number | 54-84-2 |
Synonyms | N-[2-[[3-(Dimethylamino)propyl]thio]phenyl]-3-phenyl-2-propenamide hydrochloride |
Molecular Formula | C20H25ClN2OS |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Soluble to 50 mM in water |
Storage | Store at RT |
IUPAC Name | (E)-N-[2-[3-(dimethylamino)propylsulfanyl]phenyl]-3-phenylprop-2-enamide;hydrochloride |
InChI | InChI=1S/C20H24N2OS.ClH/c1-22(2)15-8-16-24-19-12-7-6-11-18(19)21-20(23)14-13-17-9-4-3-5-10-17;/h3-7,9-14H,8,15-16H2,1-2H3,(H,21,23);1H/b14-13+; |
InChIKey | LXGJPDKYMJJWRB-IERUDJENSA-N |
SMILES | CN(C)CCCSC1=CC=CC=C1NC(=O)/C=C/C2=CC=CC=C2.Cl |